C24H33ClN4OS — CID 4088328
3-(2-chloro-4-methylphenyl)-1-[[4-(dimethylamino)phenyl]methyl]-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 4088328) has the molecular formula C24H33ClN4OS and a molecular weight of 461.08 g/mol. Its IUPAC name is 3-(2-chloro-4-methylphenyl)-1-[[4-(dimethylamino)phenyl]methyl]-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 3-(2-chloro-4-methylphenyl)-1-[[4-(dimethylamino)phenyl]methyl]-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 4088328 |
| Molecular Formula | C24H33ClN4OS |
| Molecular Weight | 461.08 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 3-(2-chloro-4-methylphenyl)-1-[[4-(dimethylamino)phenyl]methyl]-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(CCCN2CCOCC2)Cc2ccc(N(C)C)cc2)c(Cl)c1 |
| InChI | InChI=1S/C24H33ClN4OS/c1-19-5-10-23(22(25)17-19)26-24(31)29(12-4-11-28-13-15-30-16-14-28)18-20-6-8-21(9-7-20)27(2)3/h5-10,17H,4,11-16,18H2,1-3H3,(H,26,31) |
| InChIKey | LDJDHRIGUMBISS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.08 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|