C18H27N3O5 — CID 58001298
4-[[3-(dimethylamino)propyl-[(2-ethoxy-2-oxoethyl)carbamoyl]amino]methyl]benzoic acid (PubChem CID 58001298) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-[[3-(dimethylamino)propyl-[(2-ethoxy-2-oxoethyl)carbamoyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[3-(dimethylamino)propyl-[(2-ethoxy-2-oxoethyl)carbamoyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 58001298 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 4-[[3-(dimethylamino)propyl-[(2-ethoxy-2-oxoethyl)carbamoyl]amino]methyl]benzoic acid |
| SMILES | CCOC(=O)CNC(=O)N(CCCN(C)C)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H27N3O5/c1-4-26-16(22)12-19-18(25)21(11-5-10-20(2)3)13-14-6-8-15(9-7-14)17(23)24/h6-9H,4-5,10-13H2,1-3H3,(H,19,25)(H,23,24) |
| InChIKey | MGZWRFILYUIKCY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |