C18H27N3O5 — CID 68805721
4-[4-(dimethylamino)-1-[(2-ethoxy-2-oxoethyl)carbamoylamino]butyl]benzoic acid (PubChem CID 68805721) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is 4-[4-(dimethylamino)-1-[(2-ethoxy-2-oxoethyl)carbamoylamino]butyl]benzoic acid.
| Compound Name | 4-[4-(dimethylamino)-1-[(2-ethoxy-2-oxoethyl)carbamoylamino]butyl]benzoic acid |
|---|---|
| PubChem CID | 68805721 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 4-[4-(dimethylamino)-1-[(2-ethoxy-2-oxoethyl)carbamoylamino]butyl]benzoic acid |
| SMILES | CCOC(=O)CNC(=O)NC(CCCN(C)C)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H27N3O5/c1-4-26-16(22)12-19-18(25)20-15(6-5-11-21(2)3)13-7-9-14(10-8-13)17(23)24/h7-10,15H,4-6,11-12H2,1-3H3,(H,23,24)(H2,19,20,25) |
| InChIKey | JXZHXABHUKGGRQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |