C21H27N3O4 — CID 68806304
4-[4-(dimethylamino)-1-[(2-methoxyphenyl)carbamoylamino]butyl]benzoic acid (PubChem CID 68806304) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 4-[4-(dimethylamino)-1-[(2-methoxyphenyl)carbamoylamino]butyl]benzoic acid.
| Compound Name | 4-[4-(dimethylamino)-1-[(2-methoxyphenyl)carbamoylamino]butyl]benzoic acid |
|---|---|
| PubChem CID | 68806304 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 4-[4-(dimethylamino)-1-[(2-methoxyphenyl)carbamoylamino]butyl]benzoic acid |
| SMILES | COc1ccccc1NC(=O)NC(CCCN(C)C)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H27N3O4/c1-24(2)14-6-8-17(15-10-12-16(13-11-15)20(25)26)22-21(27)23-18-7-4-5-9-19(18)28-3/h4-5,7,9-13,17H,6,8,14H2,1-3H3,(H,25,26)(H2,22,23,27) |
| InChIKey | VTRFZQRHNURSNC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |