C28H40N2O5 — CID 22924110
ethyl 2-[4-[1-[(2-methoxyphenyl)carbamoylamino]octyl]phenoxy]-2-methylpropanoate (PubChem CID 22924110) has the molecular formula C28H40N2O5 and a molecular weight of 484.64 g/mol. Its IUPAC name is ethyl 2-[4-[1-[(2-methoxyphenyl)carbamoylamino]octyl]phenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[4-[1-[(2-methoxyphenyl)carbamoylamino]octyl]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 22924110 |
| Molecular Formula | C28H40N2O5 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | ethyl 2-[4-[1-[(2-methoxyphenyl)carbamoylamino]octyl]phenoxy]-2-methylpropanoate |
| SMILES | CCCCCCCC(NC(=O)Nc1ccccc1OC)c1ccc(OC(C)(C)C(=O)OCC)cc1 |
| InChI | InChI=1S/C28H40N2O5/c1-6-8-9-10-11-14-23(29-27(32)30-24-15-12-13-16-25(24)33-5)21-17-19-22(20-18-21)35-28(3,4)26(31)34-7-2/h12-13,15-20,23H,6-11,14H2,1-5H3,(H2,29,30,32) |
| InChIKey | RIWBHJZPFPNBOV-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|