C27H33N5O2 — CID 67423457
N-(2-aminophenyl)-4-[4-(dimethylamino)-1-[(4-methylphenyl)carbamoylamino]butyl]benzamide (PubChem CID 67423457) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[4-(dimethylamino)-1-[(4-methylphenyl)carbamoylamino]butyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[4-(dimethylamino)-1-[(4-methylphenyl)carbamoylamino]butyl]benzamide |
|---|---|
| PubChem CID | 67423457 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | N-(2-aminophenyl)-4-[4-(dimethylamino)-1-[(4-methylphenyl)carbamoylamino]butyl]benzamide |
| SMILES | Cc1ccc(NC(=O)NC(CCCN(C)C)c2ccc(C(=O)Nc3ccccc3N)cc2)cc1 |
| InChI | InChI=1S/C27H33N5O2/c1-19-10-16-22(17-11-19)29-27(34)31-24(9-6-18-32(2)3)20-12-14-21(15-13-20)26(33)30-25-8-5-4-7-23(25)28/h4-5,7-8,10-17,24H,6,9,18,28H2,1-3H3,(H,30,33)(H2,29,31,34) |
| InChIKey | JFMBWWVLPRBKGY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|