C25H28FN5O2 — CID 68808140
N-(2-aminophenyl)-4-[3-(dimethylamino)-1-[(4-fluorophenyl)carbamoylamino]propyl]benzamide (PubChem CID 68808140) has the molecular formula C25H28FN5O2 and a molecular weight of 449.53 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[3-(dimethylamino)-1-[(4-fluorophenyl)carbamoylamino]propyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[3-(dimethylamino)-1-[(4-fluorophenyl)carbamoylamino]propyl]benzamide |
|---|---|
| PubChem CID | 68808140 |
| Molecular Formula | C25H28FN5O2 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | N-(2-aminophenyl)-4-[3-(dimethylamino)-1-[(4-fluorophenyl)carbamoylamino]propyl]benzamide |
| SMILES | CN(C)CCC(NC(=O)Nc1ccc(F)cc1)c1ccc(C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C25H28FN5O2/c1-31(2)16-15-22(30-25(33)28-20-13-11-19(26)12-14-20)17-7-9-18(10-8-17)24(32)29-23-6-4-3-5-21(23)27/h3-14,22H,15-16,27H2,1-2H3,(H,29,32)(H2,28,30,33) |
| InChIKey | SFAKKCIYHMPQAZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|