C30H36FN5O2 — CID 69026373
N-(2-aminophenyl)-4-[1-[(3-fluorophenyl)carbamoylamino]-4-(4-methylpiperidin-1-yl)butyl]benzamide (PubChem CID 69026373) has the molecular formula C30H36FN5O2 and a molecular weight of 517.65 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[1-[(3-fluorophenyl)carbamoylamino]-4-(4-methylpiperidin-1-yl)butyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[1-[(3-fluorophenyl)carbamoylamino]-4-(4-methylpiperidin-1-yl)butyl]benzamide |
|---|---|
| PubChem CID | 69026373 |
| Molecular Formula | C30H36FN5O2 |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | N-(2-aminophenyl)-4-[1-[(3-fluorophenyl)carbamoylamino]-4-(4-methylpiperidin-1-yl)butyl]benzamide |
| SMILES | CC1CCN(CCCC(NC(=O)Nc2cccc(F)c2)c2ccc(C(=O)Nc3ccccc3N)cc2)CC1 |
| InChI | InChI=1S/C30H36FN5O2/c1-21-15-18-36(19-16-21)17-5-10-27(35-30(38)33-25-7-4-6-24(31)20-25)22-11-13-23(14-12-22)29(37)34-28-9-3-2-8-26(28)32/h2-4,6-9,11-14,20-21,27H,5,10,15-19,32H2,1H3,(H,34,37)(H2,33,35,38) |
| InChIKey | ZMTLXKXFRAKTSF-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|