C25H28N4O3 — CID 67421828
N-(2-aminophenyl)-4-[3-hydroxy-1-(2-phenylethylcarbamoylamino)propyl]benzamide (PubChem CID 67421828) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[3-hydroxy-1-(2-phenylethylcarbamoylamino)propyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[3-hydroxy-1-(2-phenylethylcarbamoylamino)propyl]benzamide |
|---|---|
| PubChem CID | 67421828 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-(2-aminophenyl)-4-[3-hydroxy-1-(2-phenylethylcarbamoylamino)propyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(C(CCO)NC(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H28N4O3/c26-21-8-4-5-9-23(21)28-24(31)20-12-10-19(11-13-20)22(15-17-30)29-25(32)27-16-14-18-6-2-1-3-7-18/h1-13,22,30H,14-17,26H2,(H,28,31)(H2,27,29,32) |
| InChIKey | IUYDBYZLMBAJCA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|