C24H25N3O5 — CID 59544807
(4-aminophenyl)methyl N-[(1R)-3-hydroxy-1-[4-[(2-hydroxyphenyl)carbamoyl]phenyl]propyl]carbamate (PubChem CID 59544807) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is (4-aminophenyl)methyl N-[(1R)-3-hydroxy-1-[4-[(2-hydroxyphenyl)carbamoyl]phenyl]propyl]carbamate.
| Compound Name | (4-aminophenyl)methyl N-[(1R)-3-hydroxy-1-[4-[(2-hydroxyphenyl)carbamoyl]phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 59544807 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | (4-aminophenyl)methyl N-[(1R)-3-hydroxy-1-[4-[(2-hydroxyphenyl)carbamoyl]phenyl]propyl]carbamate |
| SMILES | Nc1ccc(COC(=O)N[C@H](CCO)c2ccc(C(=O)Nc3ccccc3O)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O5/c25-19-11-5-16(6-12-19)15-32-24(31)27-20(13-14-28)17-7-9-18(10-8-17)23(30)26-21-3-1-2-4-22(21)29/h1-12,20,28-29H,13-15,25H2,(H,26,30)(H,27,31)/t20-/m1/s1 |
| InChIKey | MZJUJSLOLOEBQR-HXUWFJFHSA-N |
| XLogP | 3.58 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|