C28H27F3N2O3S — CID 59544722
[4-[(2-sulfanylphenyl)carbamoyl]phenyl]methyl N-[(1S)-3-cyclopropyl-1-[4-(trifluoromethyl)phenyl]propyl]carbamate (PubChem CID 59544722) has the molecular formula C28H27F3N2O3S and a molecular weight of 528.60 g/mol. Its IUPAC name is [4-[(2-sulfanylphenyl)carbamoyl]phenyl]methyl N-[(1S)-3-cyclopropyl-1-[4-(trifluoromethyl)phenyl]propyl]carbamate.
| Compound Name | [4-[(2-sulfanylphenyl)carbamoyl]phenyl]methyl N-[(1S)-3-cyclopropyl-1-[4-(trifluoromethyl)phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 59544722 |
| Molecular Formula | C28H27F3N2O3S |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | [4-[(2-sulfanylphenyl)carbamoyl]phenyl]methyl N-[(1S)-3-cyclopropyl-1-[4-(trifluoromethyl)phenyl]propyl]carbamate |
| SMILES | O=C(N[C@@H](CCC1CC1)c1ccc(C(F)(F)F)cc1)OCc1ccc(C(=O)Nc2ccccc2S)cc1 |
| InChI | InChI=1S/C28H27F3N2O3S/c29-28(30,31)22-14-12-20(13-15-22)23(16-9-18-5-6-18)33-27(35)36-17-19-7-10-21(11-8-19)26(34)32-24-3-1-2-4-25(24)37/h1-4,7-8,10-15,18,23,37H,5-6,9,16-17H2,(H,32,34)(H,33,35)/t23-/m0/s1 |
| InChIKey | WBTQKQJQUBJGHB-QHCPKHFHSA-N |
| XLogP | 7.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|