C25H23F3N2O3S — CID 59544622
(4-methylphenyl)methyl N-[(1R)-3,3,3-trifluoro-1-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]propyl]carbamate (PubChem CID 59544622) has the molecular formula C25H23F3N2O3S and a molecular weight of 488.53 g/mol. Its IUPAC name is (4-methylphenyl)methyl N-[(1R)-3,3,3-trifluoro-1-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]propyl]carbamate.
| Compound Name | (4-methylphenyl)methyl N-[(1R)-3,3,3-trifluoro-1-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 59544622 |
| Molecular Formula | C25H23F3N2O3S |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | (4-methylphenyl)methyl N-[(1R)-3,3,3-trifluoro-1-[4-[(2-sulfanylphenyl)carbamoyl]phenyl]propyl]carbamate |
| SMILES | Cc1ccc(COC(=O)N[C@H](CC(F)(F)F)c2ccc(C(=O)Nc3ccccc3S)cc2)cc1 |
| InChI | InChI=1S/C25H23F3N2O3S/c1-16-6-8-17(9-7-16)15-33-24(32)30-21(14-25(26,27)28)18-10-12-19(13-11-18)23(31)29-20-4-2-3-5-22(20)34/h2-13,21,34H,14-15H2,1H3,(H,29,31)(H,30,32)/t21-/m1/s1 |
| InChIKey | JXQQSEHFIJLXGP-OAQYLSRUSA-N |
| XLogP | 6.46 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|