C24H24N6O3 — CID 69018217
N-(2-aminophenyl)-5-[1-[(4-cyanophenyl)carbamoylamino]-4-hydroxybutyl]pyridine-2-carboxamide (PubChem CID 69018217) has the molecular formula C24H24N6O3 and a molecular weight of 444.50 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[1-[(4-cyanophenyl)carbamoylamino]-4-hydroxybutyl]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[1-[(4-cyanophenyl)carbamoylamino]-4-hydroxybutyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 69018217 |
| Molecular Formula | C24H24N6O3 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | N-(2-aminophenyl)-5-[1-[(4-cyanophenyl)carbamoylamino]-4-hydroxybutyl]pyridine-2-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)NC(CCCO)c2ccc(C(=O)Nc3ccccc3N)nc2)cc1 |
| InChI | InChI=1S/C24H24N6O3/c25-14-16-7-10-18(11-8-16)28-24(33)30-20(6-3-13-31)17-9-12-22(27-15-17)23(32)29-21-5-2-1-4-19(21)26/h1-2,4-5,7-12,15,20,31H,3,6,13,26H2,(H,29,32)(H2,28,30,33) |
| InChIKey | IAISHNHKTYGFEW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 153.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|