C26H29N7O2 — CID 25033160
N-(2-aminophenyl)-5-[1-(carbamoylamino)-4-(4-cyanophenyl)-4-(dimethylamino)butyl]pyridine-2-carboxamide (PubChem CID 25033160) has the molecular formula C26H29N7O2 and a molecular weight of 471.57 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[1-(carbamoylamino)-4-(4-cyanophenyl)-4-(dimethylamino)butyl]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[1-(carbamoylamino)-4-(4-cyanophenyl)-4-(dimethylamino)butyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 25033160 |
| Molecular Formula | C26H29N7O2 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | N-(2-aminophenyl)-5-[1-(carbamoylamino)-4-(4-cyanophenyl)-4-(dimethylamino)butyl]pyridine-2-carboxamide |
| SMILES | CN(C)C(CCC(NC(N)=O)c1ccc(C(=O)Nc2ccccc2N)nc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C26H29N7O2/c1-33(2)24(18-9-7-17(15-27)8-10-18)14-13-21(32-26(29)35)19-11-12-23(30-16-19)25(34)31-22-6-4-3-5-20(22)28/h3-12,16,21,24H,13-14,28H2,1-2H3,(H,31,34)(H3,29,32,35) |
| InChIKey | UNLBWHYQDXWBDR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 150.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|