C23H21F2N5O4 — CID 69018584
4-[6-[(2-aminophenyl)carbamoyl]-3-pyridinyl]-4-[(3,4-difluorophenyl)carbamoylamino]butanoic acid (PubChem CID 69018584) has the molecular formula C23H21F2N5O4 and a molecular weight of 469.45 g/mol. Its IUPAC name is 4-[6-[(2-aminophenyl)carbamoyl]-3-pyridinyl]-4-[(3,4-difluorophenyl)carbamoylamino]butanoic acid.
| Compound Name | 4-[6-[(2-aminophenyl)carbamoyl]-3-pyridinyl]-4-[(3,4-difluorophenyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 69018584 |
| Molecular Formula | C23H21F2N5O4 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 4-[6-[(2-aminophenyl)carbamoyl]-3-pyridinyl]-4-[(3,4-difluorophenyl)carbamoylamino]butanoic acid |
| SMILES | Nc1ccccc1NC(=O)c1ccc(C(CCC(=O)O)NC(=O)Nc2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C23H21F2N5O4/c24-15-7-6-14(11-16(15)25)28-23(34)30-18(9-10-21(31)32)13-5-8-20(27-12-13)22(33)29-19-4-2-1-3-17(19)26/h1-8,11-12,18H,9-10,26H2,(H,29,33)(H,31,32)(H2,28,30,34) |
| InChIKey | SNTXGNGWTLLLGR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 146.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|