C27H30N6O3 — CID 25033238
N-(2-aminophenyl)-5-[1-(carbamoylamino)-4-(dimethylamino)-6-oxo-5-phenylhex-5-enyl]pyridine-2-carboxamide (PubChem CID 25033238) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[1-(carbamoylamino)-4-(dimethylamino)-6-oxo-5-phenylhex-5-enyl]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[1-(carbamoylamino)-4-(dimethylamino)-6-oxo-5-phenylhex-5-enyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 25033238 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | N-(2-aminophenyl)-5-[1-(carbamoylamino)-4-(dimethylamino)-6-oxo-5-phenylhex-5-enyl]pyridine-2-carboxamide |
| SMILES | CN(C)C(CCC(NC(N)=O)c1ccc(C(=O)Nc2ccccc2N)nc1)C(=C=O)c1ccccc1 |
| InChI | InChI=1S/C27H30N6O3/c1-33(2)25(20(17-34)18-8-4-3-5-9-18)15-14-22(32-27(29)36)19-12-13-24(30-16-19)26(35)31-23-11-7-6-10-21(23)28/h3-13,16,22,25H,14-15,28H2,1-2H3,(H,31,35)(H3,29,32,36) |
| InChIKey | SBXKPCILXIDPGJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 143.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|