About N-acetyl-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide;butane;ethane
N-acetyl-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide;butane;ethane (PubChem CID 178103648) has the molecular formula C17H37N3O2
and a molecular weight of 315.50 g/mol. Its IUPAC name is N-acetyl-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide;butane;ethane.
Molecular Properties
| Compound Name | N-acetyl-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide;butane;ethane |
| PubChem CID | 178103648 |
| Molecular Formula | C17H37N3O2 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | N-acetyl-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide;butane;ethane |
| SMILES | CC.CC(=O)N(CCN1CCN(C)CC1)C(C)=O.CCCC |
| InChI | InChI=1S/C11H21N3O2.C4H10.C2H6/c1-10(15)14(11(2)16)9-8-13-6-4-12(3)5-7-13;1-3-4-2;1-2/h4-9H2,1-3H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | KSKBDOXTZYZBKM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-acetyl-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide;butane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide;butane;ethane?
The IUPAC name of N-acetyl-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide;butane;ethane (CID 178103648) is N-acetyl-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide;butane;ethane.
What is the SMILES notation for N-acetyl-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide;butane;ethane?
The canonical SMILES for N-acetyl-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide;butane;ethane is CC.CC(=O)N(CCN1CCN(C)CC1)C(C)=O.CCCC.
What is the InChIKey of N-acetyl-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide;butane;ethane?
The InChIKey is KSKBDOXTZYZBKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2.C4H10.C2H6/c1-10(15)14(11(2)16)9-8-13-6-4-12(3)5-7-13;1-3-4-2;1-2/h4-9H2,1-3H3;3-4H2,1-2H3;1-2H3.
What are the key properties of N-acetyl-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide;butane;ethane?
N-acetyl-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide;butane;ethane has a molecular weight of 315.50 g/mol, XLogP of 2.46, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-N-[2-(4-methylpiperazin-1-yl)ethyl]acetamide;butane;ethane is sourced from PubChem (CID 178103648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).