About dihexylcarbamic acid;N-hexylhexan-1-amine
dihexylcarbamic acid;N-hexylhexan-1-amine (PubChem CID 174945078) has the molecular formula C25H54N2O2
and a molecular weight of 414.72 g/mol. Its IUPAC name is dihexylcarbamic acid;N-hexylhexan-1-amine.
Molecular Properties
| Compound Name | dihexylcarbamic acid;N-hexylhexan-1-amine |
| PubChem CID | 174945078 |
| Molecular Formula | C25H54N2O2 |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 414.42 |
| IUPAC Name | dihexylcarbamic acid;N-hexylhexan-1-amine |
| SMILES | CCCCCCN(CCCCCC)C(=O)O.CCCCCCNCCCCCC |
| InChI | InChI=1S/C13H27NO2.C12H27N/c1-3-5-7-9-11-14(13(15)16)12-10-8-6-4-2;1-3-5-7-9-11-13-12-10-8-6-4-2/h3-12H2,1-2H3,(H,15,16);13H,3-12H2,1-2H3 |
| InChIKey | KCNBTFYHLJZQBE-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dihexylcarbamic acid;N-hexylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihexylcarbamic acid;N-hexylhexan-1-amine?
The IUPAC name of dihexylcarbamic acid;N-hexylhexan-1-amine (CID 174945078) is dihexylcarbamic acid;N-hexylhexan-1-amine.
What is the SMILES notation for dihexylcarbamic acid;N-hexylhexan-1-amine?
The canonical SMILES for dihexylcarbamic acid;N-hexylhexan-1-amine is CCCCCCN(CCCCCC)C(=O)O.CCCCCCNCCCCCC.
What is the InChIKey of dihexylcarbamic acid;N-hexylhexan-1-amine?
The InChIKey is KCNBTFYHLJZQBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2.C12H27N/c1-3-5-7-9-11-14(13(15)16)12-10-8-6-4-2;1-3-5-7-9-11-13-12-10-8-6-4-2/h3-12H2,1-2H3,(H,15,16);13H,3-12H2,1-2H3.
What are the key properties of dihexylcarbamic acid;N-hexylhexan-1-amine?
dihexylcarbamic acid;N-hexylhexan-1-amine has a molecular weight of 414.72 g/mol, XLogP of 7.86, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihexylcarbamic acid;N-hexylhexan-1-amine is sourced from PubChem (CID 174945078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).