C11H21F3N2O2 — CID 103155146
4-amino-N-butyl-3-methoxy-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 103155146) has the molecular formula C11H21F3N2O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 4-amino-N-butyl-3-methoxy-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 4-amino-N-butyl-3-methoxy-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 103155146 |
| Molecular Formula | C11H21F3N2O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 4-amino-N-butyl-3-methoxy-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)CC(CN)OC |
| InChI | InChI=1S/C11H21F3N2O2/c1-3-4-5-16(8-11(12,13)14)10(17)6-9(7-15)18-2/h9H,3-8,15H2,1-2H3 |
| InChIKey | CQFSAVCEWVTSMO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |