C13H28N2O2 — CID 103154284
4-amino-N,N-dibutyl-3-methoxybutanamide (PubChem CID 103154284) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 4-amino-N,N-dibutyl-3-methoxybutanamide.
| Compound Name | 4-amino-N,N-dibutyl-3-methoxybutanamide |
|---|---|
| PubChem CID | 103154284 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 4-amino-N,N-dibutyl-3-methoxybutanamide |
| SMILES | CCCCN(CCCC)C(=O)CC(CN)OC |
| InChI | InChI=1S/C13H28N2O2/c1-4-6-8-15(9-7-5-2)13(16)10-12(11-14)17-3/h12H,4-11,14H2,1-3H3 |
| InChIKey | JJNAYFNQTUDKCR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |