C9H13ClF3NO3 — CID 54875687
methyl 3-[2-chloropropanoyl(2,2,2-trifluoroethyl)amino]propanoate (PubChem CID 54875687) has the molecular formula C9H13ClF3NO3 and a molecular weight of 275.65 g/mol. Its IUPAC name is methyl 3-[2-chloropropanoyl(2,2,2-trifluoroethyl)amino]propanoate.
| Compound Name | methyl 3-[2-chloropropanoyl(2,2,2-trifluoroethyl)amino]propanoate |
|---|---|
| PubChem CID | 54875687 |
| Molecular Formula | C9H13ClF3NO3 |
| Molecular Weight | 275.65 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | methyl 3-[2-chloropropanoyl(2,2,2-trifluoroethyl)amino]propanoate |
| SMILES | COC(=O)CCN(CC(F)(F)F)C(=O)C(C)Cl |
| InChI | InChI=1S/C9H13ClF3NO3/c1-6(10)8(16)14(5-9(11,12)13)4-3-7(15)17-2/h6H,3-5H2,1-2H3 |
| InChIKey | GRXVZZNBMGEMTA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.65 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|