C12H16F3NO5 — CID 76992609
4-[(3-methoxy-3-oxopropyl)-(2,2,2-trifluoroethyl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid (PubChem CID 76992609) has the molecular formula C12H16F3NO5 and a molecular weight of 311.26 g/mol. Its IUPAC name is 4-[(3-methoxy-3-oxopropyl)-(2,2,2-trifluoroethyl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid.
| Compound Name | 4-[(3-methoxy-3-oxopropyl)-(2,2,2-trifluoroethyl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76992609 |
| Molecular Formula | C12H16F3NO5 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 4-[(3-methoxy-3-oxopropyl)-(2,2,2-trifluoroethyl)amino]-2,3-dimethyl-4-oxobut-2-enoic acid |
| SMILES | COC(=O)CCN(CC(F)(F)F)C(=O)C(C)=C(C)C(=O)O |
| InChI | InChI=1S/C12H16F3NO5/c1-7(8(2)11(19)20)10(18)16(6-12(13,14)15)5-4-9(17)21-3/h4-6H2,1-3H3,(H,19,20) |
| InChIKey | UTJLSERWWRWZSG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|