C12H14Br2F3NO2S — CID 112727891
4,5-dibromo-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide (PubChem CID 112727891) has the molecular formula C12H14Br2F3NO2S and a molecular weight of 453.12 g/mol. Its IUPAC name is 4,5-dibromo-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 112727891 |
| Molecular Formula | C12H14Br2F3NO2S |
| Molecular Weight | 453.12 g/mol |
| Exact Mass | 450.91 |
| IUPAC Name | 4,5-dibromo-N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide |
| SMILES | CCOCCCN(CC(F)(F)F)C(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H14Br2F3NO2S/c1-2-20-5-3-4-18(7-12(15,16)17)11(19)9-6-8(13)10(14)21-9/h6H,2-5,7H2,1H3 |
| InChIKey | ZZEUYKSYADVTJZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.12 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|