C8H12BrF6N — CID 107488246
N-(2-bromoethyl)-4,4,4-trifluoro-N-(2,2,2-trifluoroethyl)butan-1-amine (PubChem CID 107488246) has the molecular formula C8H12BrF6N and a molecular weight of 316.08 g/mol. Its IUPAC name is N-(2-bromoethyl)-4,4,4-trifluoro-N-(2,2,2-trifluoroethyl)butan-1-amine.
| Compound Name | N-(2-bromoethyl)-4,4,4-trifluoro-N-(2,2,2-trifluoroethyl)butan-1-amine |
|---|---|
| PubChem CID | 107488246 |
| Molecular Formula | C8H12BrF6N |
| Molecular Weight | 316.08 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | N-(2-bromoethyl)-4,4,4-trifluoro-N-(2,2,2-trifluoroethyl)butan-1-amine |
| SMILES | FC(F)(F)CCCN(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C8H12BrF6N/c9-3-5-16(6-8(13,14)15)4-1-2-7(10,11)12/h1-6H2 |
| InChIKey | UYRMYMHGJMXZIR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.08 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|