C10H19BrF3NO — CID 107488262
N-(2-bromoethyl)-3-methoxy-3-methyl-N-(2,2,2-trifluoroethyl)butan-1-amine (PubChem CID 107488262) has the molecular formula C10H19BrF3NO and a molecular weight of 306.17 g/mol. Its IUPAC name is N-(2-bromoethyl)-3-methoxy-3-methyl-N-(2,2,2-trifluoroethyl)butan-1-amine.
| Compound Name | N-(2-bromoethyl)-3-methoxy-3-methyl-N-(2,2,2-trifluoroethyl)butan-1-amine |
|---|---|
| PubChem CID | 107488262 |
| Molecular Formula | C10H19BrF3NO |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | N-(2-bromoethyl)-3-methoxy-3-methyl-N-(2,2,2-trifluoroethyl)butan-1-amine |
| SMILES | COC(C)(C)CCN(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C10H19BrF3NO/c1-9(2,16-3)4-6-15(7-5-11)8-10(12,13)14/h4-8H2,1-3H3 |
| InChIKey | YYICTISUSPKMIG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|