C13H17BrF3NO2 — CID 107488340
N-(2-bromoethyl)-2,2,2-trifluoro-N-[2-(2-methoxyphenoxy)ethyl]ethanamine (PubChem CID 107488340) has the molecular formula C13H17BrF3NO2 and a molecular weight of 356.18 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,2,2-trifluoro-N-[2-(2-methoxyphenoxy)ethyl]ethanamine.
| Compound Name | N-(2-bromoethyl)-2,2,2-trifluoro-N-[2-(2-methoxyphenoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 107488340 |
| Molecular Formula | C13H17BrF3NO2 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N-(2-bromoethyl)-2,2,2-trifluoro-N-[2-(2-methoxyphenoxy)ethyl]ethanamine |
| SMILES | COc1ccccc1OCCN(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C13H17BrF3NO2/c1-19-11-4-2-3-5-12(11)20-9-8-18(7-6-14)10-13(15,16)17/h2-5H,6-10H2,1H3 |
| InChIKey | DLZMWXUBUSFSIL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|