3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid

C12H22N2O2 — CID 79623580

IUPAC3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid
SMILESCC(C)CN(CCC#N)CC(C)(C)C(=O)O
InChIInChI=1S/C12H22N2O2/c1-10(2)8-14(7-5-6-13)9-12(3,4)11(15)16/h10H,5,7-9H2,1-4H3,(H,15,16)
InChIKeyNZNHGYYOXXFUAW-UHFFFAOYSA-N
MW226.32 g/mol
LogP1.97
Rot. Bonds7

About 3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid

3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid (PubChem CID 79623580) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid
PubChem CID79623580
Molecular FormulaC12H22N2O2
Molecular Weight226.32 g/mol
Exact Mass226.17
IUPAC Name3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid
SMILESCC(C)CN(CCC#N)CC(C)(C)C(=O)O
InChIInChI=1S/C12H22N2O2/c1-10(2)8-14(7-5-6-13)9-12(3,4)11(15)16/h10H,5,7-9H2,1-4H3,(H,15,16)
InChIKeyNZNHGYYOXXFUAW-UHFFFAOYSA-N
XLogP1.97
TPSA64.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.32
LogP ≤ 51.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid?
The IUPAC name of 3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid (CID 79623580) is 3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid is CC(C)CN(CCC#N)CC(C)(C)C(=O)O.
What is the InChIKey of 3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid?
The InChIKey is NZNHGYYOXXFUAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-10(2)8-14(7-5-6-13)9-12(3,4)11(15)16/h10H,5,7-9H2,1-4H3,(H,15,16).
What are the key properties of 3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid?
3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid has a molecular weight of 226.32 g/mol, XLogP of 1.97, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-cyanoethyl(2-methylpropyl)amino]-2,2-dimethylpropanoic acid is sourced from PubChem (CID 79623580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).