C12H26N2O4 — CID 64709529
2-amino-4-[bis(2-methoxyethyl)amino]-2-methylpentanoic acid (PubChem CID 64709529) has the molecular formula C12H26N2O4 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-amino-4-[bis(2-methoxyethyl)amino]-2-methylpentanoic acid.
| Compound Name | 2-amino-4-[bis(2-methoxyethyl)amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 64709529 |
| Molecular Formula | C12H26N2O4 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2-amino-4-[bis(2-methoxyethyl)amino]-2-methylpentanoic acid |
| SMILES | COCCN(CCOC)C(C)CC(C)(N)C(=O)O |
| InChI | InChI=1S/C12H26N2O4/c1-10(9-12(2,13)11(15)16)14(5-7-17-3)6-8-18-4/h10H,5-9,13H2,1-4H3,(H,15,16) |
| InChIKey | CPRKBSQRSVFAOD-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |