C12H24N2O5 — CID 62820777
2-[bis(2-methoxyethyl)carbamoyl-methylamino]-2-methylpropanoic acid (PubChem CID 62820777) has the molecular formula C12H24N2O5 and a molecular weight of 276.33 g/mol. Its IUPAC name is 2-[bis(2-methoxyethyl)carbamoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 2-[bis(2-methoxyethyl)carbamoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62820777 |
| Molecular Formula | C12H24N2O5 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2-[bis(2-methoxyethyl)carbamoyl-methylamino]-2-methylpropanoic acid |
| SMILES | COCCN(CCOC)C(=O)N(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H24N2O5/c1-12(2,10(15)16)13(3)11(17)14(6-8-18-4)7-9-19-5/h6-9H2,1-5H3,(H,15,16) |
| InChIKey | FRXQDCAWSKECFE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |