C15H18ClNO5 — CID 22796477
(2S)-2-[(4-chlorobenzoyl)-ethylamino]-2-ethylbutanedioic acid (PubChem CID 22796477) has the molecular formula C15H18ClNO5 and a molecular weight of 327.76 g/mol. Its IUPAC name is (2S)-2-[(4-chlorobenzoyl)-ethylamino]-2-ethylbutanedioic acid.
| Compound Name | (2S)-2-[(4-chlorobenzoyl)-ethylamino]-2-ethylbutanedioic acid |
|---|---|
| PubChem CID | 22796477 |
| Molecular Formula | C15H18ClNO5 |
| Molecular Weight | 327.76 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (2S)-2-[(4-chlorobenzoyl)-ethylamino]-2-ethylbutanedioic acid |
| SMILES | CCN(C(=O)c1ccc(Cl)cc1)[C@@](CC)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H18ClNO5/c1-3-15(14(21)22,9-12(18)19)17(4-2)13(20)10-5-7-11(16)8-6-10/h5-8H,3-4,9H2,1-2H3,(H,18,19)(H,21,22)/t15-/m0/s1 |
| InChIKey | LPISHJNMPNQTLI-HNNXBMFYSA-N |
| XLogP | 2.51 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.76 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |