C20H27NO6 — CID 174491017
(2S)-2-ethyl-2-[ethyl-[4-(4-oxobutyl)benzoyl]amino]pentanedioic acid (PubChem CID 174491017) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is (2S)-2-ethyl-2-[ethyl-[4-(4-oxobutyl)benzoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-ethyl-2-[ethyl-[4-(4-oxobutyl)benzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 174491017 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (2S)-2-ethyl-2-[ethyl-[4-(4-oxobutyl)benzoyl]amino]pentanedioic acid |
| SMILES | CCN(C(=O)c1ccc(CCCC=O)cc1)[C@@](CC)(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H27NO6/c1-3-20(19(26)27,13-12-17(23)24)21(4-2)18(25)16-10-8-15(9-11-16)7-5-6-14-22/h8-11,14H,3-7,12-13H2,1-2H3,(H,23,24)(H,26,27)/t20-/m0/s1 |
| InChIKey | YAUXUMZJBSOCIN-FQEVSTJZSA-N |
| XLogP | 2.77 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|