C11H19NO4 — CID 157202172
(diacetylamino) 3,3-dimethylpentanoate (PubChem CID 157202172) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is (diacetylamino) 3,3-dimethylpentanoate.
| Compound Name | (diacetylamino) 3,3-dimethylpentanoate |
|---|---|
| PubChem CID | 157202172 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (diacetylamino) 3,3-dimethylpentanoate |
| SMILES | CCC(C)(C)CC(=O)ON(C(C)=O)C(C)=O |
| InChI | InChI=1S/C11H19NO4/c1-6-11(4,5)7-10(15)16-12(8(2)13)9(3)14/h6-7H2,1-5H3 |
| InChIKey | UACGCGFJKCMUEL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|