C26H43NO6 — CID 157202171
(diacetylamino) 3,3-dimethylpentanoate;ethane;[4-(2-methylbutan-2-yl)phenyl] acetate (PubChem CID 157202171) has the molecular formula C26H43NO6 and a molecular weight of 465.63 g/mol. Its IUPAC name is (diacetylamino) 3,3-dimethylpentanoate;ethane;[4-(2-methylbutan-2-yl)phenyl] acetate.
| Compound Name | (diacetylamino) 3,3-dimethylpentanoate;ethane;[4-(2-methylbutan-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 157202171 |
| Molecular Formula | C26H43NO6 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | (diacetylamino) 3,3-dimethylpentanoate;ethane;[4-(2-methylbutan-2-yl)phenyl] acetate |
| SMILES | CC.CCC(C)(C)CC(=O)ON(C(C)=O)C(C)=O.CCC(C)(C)c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C13H18O2.C11H19NO4.C2H6/c1-5-13(3,4)11-6-8-12(9-7-11)15-10(2)14;1-6-11(4,5)7-10(15)16-12(8(2)13)9(3)14;1-2/h6-9H,5H2,1-4H3;6-7H2,1-5H3;1-2H3 |
| InChIKey | AQXPSPYZQHPUOF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|