C18H28ClNO — CID 71107637
N-(3-chlorophenyl)-3,3-dimethyl-N-pentan-2-ylpentanamide (PubChem CID 71107637) has the molecular formula C18H28ClNO and a molecular weight of 309.88 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3,3-dimethyl-N-pentan-2-ylpentanamide.
| Compound Name | N-(3-chlorophenyl)-3,3-dimethyl-N-pentan-2-ylpentanamide |
|---|---|
| PubChem CID | 71107637 |
| Molecular Formula | C18H28ClNO |
| Molecular Weight | 309.88 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | N-(3-chlorophenyl)-3,3-dimethyl-N-pentan-2-ylpentanamide |
| SMILES | CCCC(C)N(C(=O)CC(C)(C)CC)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H28ClNO/c1-6-9-14(3)20(16-11-8-10-15(19)12-16)17(21)13-18(4,5)7-2/h8,10-12,14H,6-7,9,13H2,1-5H3 |
| InChIKey | YXYMWIVZVBOZNU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.88 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |