C21H35NO — CID 18735943
N-(3-ethylphenyl)-N-heptan-2-yl-3,3-dimethylbutanamide (PubChem CID 18735943) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is N-(3-ethylphenyl)-N-heptan-2-yl-3,3-dimethylbutanamide.
| Compound Name | N-(3-ethylphenyl)-N-heptan-2-yl-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 18735943 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | N-(3-ethylphenyl)-N-heptan-2-yl-3,3-dimethylbutanamide |
| SMILES | CCCCCC(C)N(C(=O)CC(C)(C)C)c1cccc(CC)c1 |
| InChI | InChI=1S/C21H35NO/c1-7-9-10-12-17(3)22(20(23)16-21(4,5)6)19-14-11-13-18(8-2)15-19/h11,13-15,17H,7-10,12,16H2,1-6H3 |
| InChIKey | FMUWJCYERZJGEX-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|