C18H29NO — CID 18735669
3,3-dimethyl-N-(3-methylphenyl)-N-pentan-3-ylbutanamide (PubChem CID 18735669) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 3,3-dimethyl-N-(3-methylphenyl)-N-pentan-3-ylbutanamide.
| Compound Name | 3,3-dimethyl-N-(3-methylphenyl)-N-pentan-3-ylbutanamide |
|---|---|
| PubChem CID | 18735669 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 3,3-dimethyl-N-(3-methylphenyl)-N-pentan-3-ylbutanamide |
| SMILES | CCC(CC)N(C(=O)CC(C)(C)C)c1cccc(C)c1 |
| InChI | InChI=1S/C18H29NO/c1-7-15(8-2)19(17(20)13-18(4,5)6)16-11-9-10-14(3)12-16/h9-12,15H,7-8,13H2,1-6H3 |
| InChIKey | KJMJELZDBSVUIG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |