C18H29NO — CID 71107442
N-butyl-N-(3-ethylphenyl)-2,2-dimethylbutanamide (PubChem CID 71107442) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is N-butyl-N-(3-ethylphenyl)-2,2-dimethylbutanamide.
| Compound Name | N-butyl-N-(3-ethylphenyl)-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 71107442 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | N-butyl-N-(3-ethylphenyl)-2,2-dimethylbutanamide |
| SMILES | CCCCN(C(=O)C(C)(C)CC)c1cccc(CC)c1 |
| InChI | InChI=1S/C18H29NO/c1-6-9-13-19(17(20)18(4,5)8-3)16-12-10-11-15(7-2)14-16/h10-12,14H,6-9,13H2,1-5H3 |
| InChIKey | SNIFHKLERUPJSZ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |