C8H14F2O — CID 112574315
1,1-difluoro-4-methylheptan-2-one (PubChem CID 112574315) has the molecular formula C8H14F2O and a molecular weight of 164.19 g/mol. Its IUPAC name is 1,1-difluoro-4-methylheptan-2-one.
| Compound Name | 1,1-difluoro-4-methylheptan-2-one |
|---|---|
| PubChem CID | 112574315 |
| Molecular Formula | C8H14F2O |
| Molecular Weight | 164.19 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | 1,1-difluoro-4-methylheptan-2-one |
| SMILES | CCCC(C)CC(=O)C(F)F |
| InChI | InChI=1S/C8H14F2O/c1-3-4-6(2)5-7(11)8(9)10/h6,8H,3-5H2,1-2H3 |
| InChIKey | CVEHSZNZDSCNER-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |