C14H29NO — CID 116574232
11-amino-4,7-dimethyldodecan-6-one (PubChem CID 116574232) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 11-amino-4,7-dimethyldodecan-6-one.
| Compound Name | 11-amino-4,7-dimethyldodecan-6-one |
|---|---|
| PubChem CID | 116574232 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 11-amino-4,7-dimethyldodecan-6-one |
| SMILES | CCCC(C)CC(=O)C(C)CCCC(C)N |
| InChI | InChI=1S/C14H29NO/c1-5-7-11(2)10-14(16)12(3)8-6-9-13(4)15/h11-13H,5-10,15H2,1-4H3 |
| InChIKey | FMAOVWDCMYKJKP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |