C6H14N2OS — CID 146520704
N,N-dimethyl-3-(methylsulfanylamino)propanamide (PubChem CID 146520704) has the molecular formula C6H14N2OS and a molecular weight of 162.26 g/mol. Its IUPAC name is N,N-dimethyl-3-(methylsulfanylamino)propanamide.
| Compound Name | N,N-dimethyl-3-(methylsulfanylamino)propanamide |
|---|---|
| PubChem CID | 146520704 |
| Molecular Formula | C6H14N2OS |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | N,N-dimethyl-3-(methylsulfanylamino)propanamide |
| SMILES | CSNCCC(=O)N(C)C |
| InChI | InChI=1S/C6H14N2OS/c1-8(2)6(9)4-5-7-10-3/h7H,4-5H2,1-3H3 |
| InChIKey | SQWVSPAWPVDOAL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|