C9H17ClN2O — CID 81431155
3-[[(E)-4-chlorobut-2-enyl]amino]-N,N-dimethylpropanamide (PubChem CID 81431155) has the molecular formula C9H17ClN2O and a molecular weight of 204.70 g/mol. Its IUPAC name is 3-[[(E)-4-chlorobut-2-enyl]amino]-N,N-dimethylpropanamide.
| Compound Name | 3-[[(E)-4-chlorobut-2-enyl]amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 81431155 |
| Molecular Formula | C9H17ClN2O |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-[[(E)-4-chlorobut-2-enyl]amino]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCNC/C=C/CCl |
| InChI | InChI=1S/C9H17ClN2O/c1-12(2)9(13)5-8-11-7-4-3-6-10/h3-4,11H,5-8H2,1-2H3/b4-3+ |
| InChIKey | MUFFJBXGCHPIOD-ONEGZZNKSA-N |
| XLogP | 0.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|