C12H21N3O3 — CID 122014373
4-[(4-cyano-2,2-dimethylbutyl)carbamoylamino]butanoic acid (PubChem CID 122014373) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 4-[(4-cyano-2,2-dimethylbutyl)carbamoylamino]butanoic acid.
| Compound Name | 4-[(4-cyano-2,2-dimethylbutyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122014373 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 4-[(4-cyano-2,2-dimethylbutyl)carbamoylamino]butanoic acid |
| SMILES | CC(C)(CCC#N)CNC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C12H21N3O3/c1-12(2,6-4-7-13)9-15-11(18)14-8-3-5-10(16)17/h3-6,8-9H2,1-2H3,(H,16,17)(H2,14,15,18) |
| InChIKey | KDAJYBAQIYKSRY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|