C11H19F3N2 — CID 115664335
4,4-dimethyl-5-(4,4,4-trifluorobutylamino)pentanenitrile (PubChem CID 115664335) has the molecular formula C11H19F3N2 and a molecular weight of 236.28 g/mol. Its IUPAC name is 4,4-dimethyl-5-(4,4,4-trifluorobutylamino)pentanenitrile.
| Compound Name | 4,4-dimethyl-5-(4,4,4-trifluorobutylamino)pentanenitrile |
|---|---|
| PubChem CID | 115664335 |
| Molecular Formula | C11H19F3N2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 4,4-dimethyl-5-(4,4,4-trifluorobutylamino)pentanenitrile |
| SMILES | CC(C)(CCC#N)CNCCCC(F)(F)F |
| InChI | InChI=1S/C11H19F3N2/c1-10(2,5-3-7-15)9-16-8-4-6-11(12,13)14/h16H,3-6,8-9H2,1-2H3 |
| InChIKey | OHOMZFSDULWVNX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|