C16H23N3O — CID 115743562
3-[(4-cyano-2,2-dimethylbutyl)amino]-N,N-dimethylbenzamide (PubChem CID 115743562) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-[(4-cyano-2,2-dimethylbutyl)amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[(4-cyano-2,2-dimethylbutyl)amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 115743562 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 3-[(4-cyano-2,2-dimethylbutyl)amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(NCC(C)(C)CCC#N)c1 |
| InChI | InChI=1S/C16H23N3O/c1-16(2,9-6-10-17)12-18-14-8-5-7-13(11-14)15(20)19(3)4/h5,7-8,11,18H,6,9,12H2,1-4H3 |
| InChIKey | GVBMVXLESJHUHI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |