C14H17F3N2 — CID 115749443
4,4-dimethyl-5-[4-(trifluoromethyl)anilino]pentanenitrile (PubChem CID 115749443) has the molecular formula C14H17F3N2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 4,4-dimethyl-5-[4-(trifluoromethyl)anilino]pentanenitrile.
| Compound Name | 4,4-dimethyl-5-[4-(trifluoromethyl)anilino]pentanenitrile |
|---|---|
| PubChem CID | 115749443 |
| Molecular Formula | C14H17F3N2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 4,4-dimethyl-5-[4-(trifluoromethyl)anilino]pentanenitrile |
| SMILES | CC(C)(CCC#N)CNc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3N2/c1-13(2,8-3-9-18)10-19-12-6-4-11(5-7-12)14(15,16)17/h4-7,19H,3,8,10H2,1-2H3 |
| InChIKey | DNLKUJCUAHVLRN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |