C14H18N6 — CID 115743436
4,4-dimethyl-5-[4-(tetrazol-1-yl)anilino]pentanenitrile (PubChem CID 115743436) has the molecular formula C14H18N6 and a molecular weight of 270.34 g/mol. Its IUPAC name is 4,4-dimethyl-5-[4-(tetrazol-1-yl)anilino]pentanenitrile.
| Compound Name | 4,4-dimethyl-5-[4-(tetrazol-1-yl)anilino]pentanenitrile |
|---|---|
| PubChem CID | 115743436 |
| Molecular Formula | C14H18N6 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 4,4-dimethyl-5-[4-(tetrazol-1-yl)anilino]pentanenitrile |
| SMILES | CC(C)(CCC#N)CNc1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C14H18N6/c1-14(2,8-3-9-15)10-16-12-4-6-13(7-5-12)20-11-17-18-19-20/h4-7,11,16H,3,8,10H2,1-2H3 |
| InChIKey | ACHZAKDHPJQQLU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |