C21H29N2O+ — CID 8794486
(4-ethylphenyl)methyl-methyl-[2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl]azanium (PubChem CID 8794486) has the molecular formula C21H29N2O+ and a molecular weight of 325.48 g/mol. Its IUPAC name is (4-ethylphenyl)methyl-methyl-[2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl]azanium.
| Compound Name | (4-ethylphenyl)methyl-methyl-[2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8794486 |
| Molecular Formula | C21H29N2O+ |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | (4-ethylphenyl)methyl-methyl-[2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl]azanium |
| SMILES | CCc1ccc(C[NH+](C)CC(=O)NCCc2ccccc2C)cc1 |
| InChI | InChI=1S/C21H28N2O/c1-4-18-9-11-19(12-10-18)15-23(3)16-21(24)22-14-13-20-8-6-5-7-17(20)2/h5-12H,4,13-16H2,1-3H3,(H,22,24)/p+1 |
| InChIKey | LTUSOOMTMAWPOD-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |