C19H27N2O3+ — CID 8692628
[2-(diethylamino)-2-oxoethyl]-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]-methylazanium (PubChem CID 8692628) has the molecular formula C19H27N2O3+ and a molecular weight of 331.44 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl]-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]-methylazanium.
| Compound Name | [2-(diethylamino)-2-oxoethyl]-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8692628 |
| Molecular Formula | C19H27N2O3+ |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl]-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]-methylazanium |
| SMILES | CCN(CC)C(=O)C[NH+](C)Cc1cc(=O)oc2c(C)c(C)ccc12 |
| InChI | InChI=1S/C19H26N2O3/c1-6-21(7-2)17(22)12-20(5)11-15-10-18(23)24-19-14(4)13(3)8-9-16(15)19/h8-10H,6-7,11-12H2,1-5H3/p+1 |
| InChIKey | SWTRGQMDIUPCPG-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 54.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|