C21H31N2O3+ — CID 8692662
[2-(diethylamino)-2-oxoethyl]-methyl-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]azanium (PubChem CID 8692662) has the molecular formula C21H31N2O3+ and a molecular weight of 359.49 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl]-methyl-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]azanium.
| Compound Name | [2-(diethylamino)-2-oxoethyl]-methyl-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 8692662 |
| Molecular Formula | C21H31N2O3+ |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl]-methyl-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]azanium |
| SMILES | CCN(CC)C(=O)C[NH+](C)Cc1cc(=O)oc2cc(C)c(C(C)C)cc12 |
| InChI | InChI=1S/C21H30N2O3/c1-7-23(8-2)20(24)13-22(6)12-16-10-21(25)26-19-9-15(5)17(14(3)4)11-18(16)19/h9-11,14H,7-8,12-13H2,1-6H3/p+1 |
| InChIKey | YLUAEKZACYIOPC-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 54.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|