C23H27NO4 — CID 8551444
4-[[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]methyl]-7,8-dimethylchromen-2-one (PubChem CID 8551444) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 4-[[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]methyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]methyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 8551444 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 4-[[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]methyl]-7,8-dimethylchromen-2-one |
| SMILES | COc1cc(C)c(CN(C)Cc2cc(=O)oc3c(C)c(C)ccc23)cc1OC |
| InChI | InChI=1S/C23H27NO4/c1-14-7-8-19-18(11-22(25)28-23(19)16(14)3)13-24(4)12-17-10-21(27-6)20(26-5)9-15(17)2/h7-11H,12-13H2,1-6H3 |
| InChIKey | YHRUJWATNGELHU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|